Product Overview
Leucettamol A | T27815 | TargetMol Chemicals
CAS: 151124-32-2
Smiles: C[C@@H](N)[C@@H](O)CCCCCC\C=C/C\C=C\C\C=C/C\C=C/C\C=C/C\C=C/C[C@H](O)[C@@H](C)N
Formula: C30H52N2O2
Pathway: N/A
Target: N/A
Receptor: N/A
Bioactivity: Leucettamol A is a leukotriene B4 receptor antagonist isolated from the marine sponge Leucetta microraphis. It inhibits the formation of a complex composed of the ubiquitin E2 enzyme Ubc13 and Uev1A.
Molecular Weight: 472, 758