Product Overview
Loline | T32849 | TargetMol Chemicals
CAS: 25161-91-5
Smiles: [H][C@]12CN3CC[C@]([H])(O1)[C@]3([H])[C@H]2NC
Formula: C8H14N2O
Pathway: N/A
Target: N/A
Receptor: N/A
Bioactivity: Loline is a natural insecticidal and deterrent to a broad range of insects, including species in the Hemiptera, Coleoptera, Hymenoptera, Lepidoptera, and Blattodea orders. Loline deters species such as the bird cherry-oat aphid (genus Rhopalosiphum), large milkweed bug (Oncopeltus fasciatus), and American cockroach (Periplaneta americana), thereby protecting the host plant from insect herbivory.
Molecular Weight: 154, 213
