Product Overview
Lomefloxacin hydrochloride | T1625 | TargetMol Chemicals
CAS: 98079-52-8
Smiles: Cl.CCn1cc(C(O)=O)c(=O)c2cc(F)c(N3CCNC(C)C3)c(F)c12
Formula: C17H20ClF2N3O3
Pathway: DNA Damage/DNA Repair|||Microbiology/Virology
Target: Topoisomerase|||Antibacterial|||Antibiotic
Receptor: N/A
Bioactivity: Lomefloxacin hydrochloride inhibits DNA gyrase, a type II topoisomerase involved in the induction or relaxation of supercoiling during DNA replication. This inhibition leads to a decrease in DNA synthesis during bacterial replication, resulting in cell growth inhibition and eventually cell lysis. Lomefloxacin Hydrochloride is the hydrochloride salt form of lomefloxacin, a synthetic broad-spectrum fluoroquinolone with antibacterial activity.
Molecular Weight: 387, 81
