Product Overview
Loureirin B | T3876 | TargetMol Chemicals
CAS: 119425-90-0
Smiles: COc1cc(OC)c(CCC(=O)c2ccc(O)cc2)c(OC)c1
Formula: C18H20O5
Pathway: MAPK|||Membrane transporter/Ion channel|||Metabolism
Target: PAI-1|||ERK|||Potassium Channel|||JNK
Receptor: N/A
Bioactivity: Loureirin B can downregulate the expression of fibrosis-related molecules by regulating MMPs and TIMPs levels, inhibit scar fibroblast proliferation and suppress TGF-β1-induced fibrosis, during which TGF-β1/Smad2/3 pathway is likely involved.
Molecular Weight: 316, 353
