Product Overview
Lucidenic acid B | TN1880 | TargetMol Chemicals
CAS: 95311-95-8
Smiles: C[C@H](CCC(O)=O)[C@H]1CC(=O)[C@@]2(C)C3=C(C(=O)[C@@H](O)[C@]12C)[C@@]1(C)CCC(=O)C(C)(C)[C@@H]1C[C@@H]3O
Formula: C27H38O7
Pathway: Apoptosis|||Chromatin/Epigenetic|||DNA Damage/DNA Repair|||Proteases/Proteasome
Target: BCL|||PARP|||Caspase
Receptor: N/A
Bioactivity: Lucidenic acid B shows antioxidative, and anti-invasive effects, it inhibits PMA-induced invasion of human hepatoma cells through inactivating MAPK/ERK signal transduction pathway and reducing binding activities of NF-kappaB and AP-1. Lucidenic acid B also has chemopreventive potential, it induces apoptosis in human leukemia cells via a mitochondria-mediated pathway.
Molecular Weight: 474, 594
