Product Overview
Luteolin 7-sulfate | T13762 | TargetMol Chemicals
CAS: 56857-57-9
Smiles: Oc1ccc(cc1O)-c1cc(=O)c2c(O)cc(OS(O)(=O)=O)cc2o1
Formula: C15H10O9S
Pathway: Others
Target: Others
Receptor: N/A
Bioactivity: Luteolin 7-sulfate attenuates TYR gene expression through the intervention of a cAMP-responsive element binding protein (CREB)- and microphthalmia-associated transcription factor (MITF)-mediated signaling pathway, leading to the decreased melanin synthesis. Luteolin 7-sulfate is isolated from Phyllospadix iwatensis Makino, a marine plant.
Molecular Weight: 366, 3
