Product Overview
LXW7 | TP1474 | TargetMol Chemicals
CAS: 1313004-77-1
Smiles: CC(C)[C@H]1NC(=O)[C@@H](CC(O)=O)NC(=O)[C@H](CC(O)=O)NC(=O)CNC(=O)[C@H](CCCNC(N)=N)NC(=O)CNC(=O)[C@H](N)CSSC[C@@H](NC1=O)C(N)=O
Formula: C29H48N12O12S2
Pathway: Cytoskeletal Signaling
Target: Integrin
Receptor: N/A
Bioactivity: LXW7 is an octamer disulfide cyclic peptide and αvβ3 integrin ligand, acts as a potent and specific endothelial progenitor cells (EPCs) and endothelial cells (ECs) targeting ligand. LXW7 is a disulfide cyclic octa-peptide (cGRGDdvc) containing unnatural amino acids flanking both sides of the main functional motif.
Molecular Weight: 820, 9
