Maribavir | T2162

Maribavir | T2162 | TargetMol Chemicals

CAS: 176161-24-3

Smiles: CC(C)Nc1nc2cc(Cl)c(Cl)cc2n1[C@H]1O[C@@H](CO)[C@H](O)[C@@H]1O

Formula: C15H19Cl2N3O4

Pathway: Microbiology/Virology|||Others|||Proteases/Proteasome

Target: Others|||HCV Protease

Receptor: N/A

Bioactivity: Maribavir is an orally available benzimidazole riboside compound with activity against cytomegalovirus (CMV). Maribavir is a selective ATP competitor of the viral UL97 kinase, which is involved in viral nuclear maturation events, such as viral DNA assembly and movement of viral capsids from the nucleus of infected cells. Maribavir has activity against strains of CMV that are resistant to standard anti-CMV agents.

Molecular Weight: 376, 24