Product Overview
MDVN1003 | T28008 | TargetMol Chemicals
CAS: 2058116-52-0
Smiles: Nc1ccc2CC(Cc2c1)n1nc(-c2cc(F)c3OCCNc3c2)c2c(N)ncnc12
Formula: C22H20FN7O
Pathway: N/A
Target: N/A
Receptor: N/A
Bioactivity: MDVN1003 is a potent inhibitor of BTK amd PI3Kδ, two proteins regulated by the B cell receptor (BCR) that drive the growth of many NHLs. MDVN1003 induces cell death in a B cell lymphoma cell line but not in an irrelevant erythroblast cell line.
Molecular Weight: 417, 448