Product Overview
Meranzin hydrate | TN1922 | TargetMol Chemicals
CAS: 5875-49-0
Smiles: COc1ccc2ccc(=O)oc2c1C[C@H](O)C(C)(C)O
Formula: C15H18O5
Pathway: GPCR/G Protein|||MAPK|||Neuroscience
Target: ERK|||Adrenergic Receptor
Receptor: N/A
Bioactivity: Meranzin hydrate exhibits antidepressive and prokinetic-like effects through the regulation of the common mediator, the alpha 2-adrenoceptor, and α±-amino-3-hydroxy-5-methyl-4-isoxazolepropionic acid receptors; it produces a rapid effect mediated by AMPA receptors and involving BDNF modulation through the ERK1/2 pathway.
Molecular Weight: 278, 304
