Product Overview
Methoprene | T16044 | TargetMol Chemicals
CAS: 40596-69-8
Smiles: COC(C)(C)CCCC(C)C\C=C\C(\C)=C\C(=O)OC(C)C
Formula: C19H34O3
Pathway: Others
Target: Others
Receptor: N/A
Bioactivity: Methoprene is a juvenile hormone (JH) mimic and a biological pesticide. Methoprene acts as an insect growth regulator interfering with the lifecycles of insects and preventing insects from reaching maturity or reproducing.
Molecular Weight: 310, 478
