Product Overview
Methylophiopogonanone A | T5S1262 | TargetMol Chemicals
CAS: 74805-92-8
Smiles: Cc1c(O)c(C)c2OC[C@@H](Cc3ccc4OCOc4c3)C(=O)c2c1O
Formula: C19H18O6
Pathway: Others
Target: Others
Receptor: N/A
Bioactivity: 1. Methylophiopogonanone A has anti-inflammatory and anti-oxidative properties. 2. Methylophiopogonanone A has therapeutic potential against cerebral I/R injury through its ability to attenuate BBB disruption by regulating the expression of MMP-9 and tight junction proteins.
Molecular Weight: 342, 347
