Product Overview
MitoEbselen-2 chloride | T33407 | TargetMol Chemicals
CAS: 1638973-78-0
Smiles: [Cl-].O=C(Cc1ccc(cc1)-n1[se]c2ccccc2c1=O)NCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1
Formula: C35H30ClN2O2PSe
Pathway: N/A
Target: N/A
Receptor: N/A
Bioactivity: MitoEbselen-2 is a radiation mitigator which reduces lipid hydroperoxides and prevents apoptotic cell death. When administered 24 hours postirradiation, MitoEbselen-2 was shown to increase the survival of mice exposed to whole body γ-irradiation.
Molecular Weight: 656, 03
