Product Overview
MKC8866 | T15594 | TargetMol Chemicals
CAS: 1338934-59-0
Smiles: COc1cc2c(C)c(CC(=O)N3CCOCC3)c(=O)oc2c(C=O)c1O
Formula: C18H19NO7
Pathway: Cell Cycle/Checkpoint
Target: IRE1
Receptor: N/A
Bioactivity: MKC8866 is a selective IRE1 RNase inhibitor (IC50: 0.29 μM in human vitro). MKC8866 inhibits IRE1 RNase in breast cancer cells leading to the decreased production of pro-tumorigenic factors and it can inhibit prostate cancer (PCa) tumor growth.
Molecular Weight: 361, 35