Product Overview
Morusin | T5S1607 | TargetMol Chemicals
CAS: 62596-29-6
Smiles: CC(C)=CCc1c(oc2c3C=CC(C)(C)Oc3cc(O)c2c1=O)-c1ccc(O)cc1O
Formula: C25H24O6
Pathway: JAK/STAT signaling|||Microbiology/Virology|||NF-Κb|||Stem Cells
Target: NF-κB|||Antibacterial|||STAT
Receptor: N/A
Bioactivity: 1. Morusin possesses antitumor effects of cell lines including HT-29, A549, MCF-7, and MDA-MB-231, through suppressing STAT3 and NFκB attenuation mediated apoptosis induction. 2. Morusin possesses anti-oxidant and anti-inflammatory effects.
Molecular Weight: 420, 461
