Product Overview
Motexafin gadolinium | T33487 | TargetMol Chemicals
CAS: 246252-06-2
Smiles: [Gd-4]1234([N+]5=C6C=[N+]1c1cc(OCCOCCOCCOC)c(cc1[N+]2=CC1=[N+]3C(=Cc2c(c(c(n42)C=C5C(CCCO)=C6C)CC)CC)C(CCCO)=C1C)OCCOCCOCCOC)(OC(=O)C)OC(=O)C
Formula: C52H72GdN5O14
Pathway: N/A
Target: N/A
Receptor: N/A
Bioactivity: Motexafin gadolinium, also known as PCI 0120, is a synthetic metallotexaphyrin with radiosensitizing and chemosensitizing properties. Motexafin gadolinium accumulates in tumor cells preferentially due to their increased rates of metabolism, generating reactive oxygen species (ROS) intracellularly and lowering the tumor cell apoptotic threshold to ionizing radiation and chemotherapy.
Molecular Weight: 1148, 42
