Product Overview
MRS 1754 | T16140 | TargetMol Chemicals
CAS: 264622-58-4
Smiles: CCCn1c2nc([nH]c2c(=O)n(CCC)c1=O)-c1ccc(OCC(=O)Nc2ccc(cc2)C#N)cc1
Formula: C26H26N6O4
Pathway: GPCR/G Protein|||Neuroscience|||Others
Target: Others|||Adenosine Receptor
Receptor: N/A
Bioactivity: MRS 1754 is a selective antagonist radioligand for the A2B adenosine receptor. It has a very low affinity for A1 and A3 receptors of both humans and rats.
Molecular Weight: 486, 532
