Product Overview
Mulberrofuran A | TN4586 | TargetMol Chemicals
CAS: 68978-04-1
Smiles: COc1cc(O)cc(-c2cc3ccc(O)cc3o2)c1C\C=C(/C)CCC=C(C)C
Formula: C25H28O4
Pathway: Immunology/Inflammation|||Neuroscience
Target: COX
Receptor: N/A
Bioactivity: Mulberrofuran A can inhibit the formations of 12-hydroxy-, 8, 10-heptadecatrienoic acid (HHT) and thromboxane B2, but it can increase the formation of 12-hydroxy-5, 8, 10, 14-eicosatetraenoic acid (12-HETE).
Molecular Weight: 392, 5
