N-(3-Methoxybenzyl)-(9Z, 12Z, 15Z)-octadecatrienamide | TN7036

N-(3-Methoxybenzyl)-(9Z, 12Z, 15Z)-octadecatrienamide | TN7036 | TargetMol Chemicals

CAS: 883715-23-9

Smiles: CC/C=C\C/C=C\C/C=C\CCCCCCCC(NCc1cc(OC)ccc1)=OCC/C=C\C/C=C\C/C=C\CCCCCCCC(NCc1cc(OC)ccc1)=O

Formula: C52H77N2O4

Pathway: Cytoskeletal Signaling|||Stem Cells

Target: Wnt/beta-catenin

Receptor: N/A

Bioactivity: N-3-methoxylBenzyllinolenicamide induces osteogenic differentiation and subsequent bone formation of mesenchymal stem cells by activating the canonical Wnt/β-catenin signaling pathway that can be used for osteoporosis research.

Molecular Weight: 794, 18