Product Overview
N-Methylcytisine | T5S0994 | TargetMol Chemicals
CAS: 486-86-2
Smiles: CN1C[C@@H]2C[C@H](C1)c1cccc(=O)n1C2
Formula: C12H16N2O
Pathway: Neuroscience|||Others
Target: Others|||AChR
Receptor: N/A
Bioactivity: 1. N-Methylcytisine's nicotinic receptors have high affinity (KD = 5 nM)to nAChR from squid optical ganglia. 2. N-Methylcytisine and N, N-dimethylcytisine did not displace 14C-tubocurarine at a concentration of .1 mM, cytisine was the only effective inhibitor of 14C-tubocurarine specific binding (Ki=7 nM).
Molecular Weight: 204, 273
