Product Overview
N-Succinimidyl-S-acetylthioacetate | T16251 | TargetMol Chemicals
CAS: 76931-93-6
Smiles: CC(=O)SCC(=O)ON1C(=O)CCC1=O
Formula: C8H9NO5S
Pathway: Others
Target: Others
Receptor: N/A
Bioactivity: N-Succinimidyl S-acetylthioacetate (SATA) is a protein modification agent that introduces thiol-groups into protein molecules and adds sulfhydryl groups in a protected form to proteins and other amine-containing molecules for later reaction with sulfhydryl reactive crosslinkers such as Sulfo-SMCC, Sulfo-MBS, etc.
Molecular Weight: 231, 22
