Product Overview
N-trans-Feruloyltyramine | T3S0645 | TargetMol Chemicals
CAS: 66648-43-9
Smiles: COc1cc(\C=C\C(=O)NCCc2ccc(O)cc2)ccc1O
Formula: C18H19NO4
Pathway: Immunology/Inflammation|||Neuroscience|||Others
Target: Others|||COX
Receptor: N/A
Bioactivity: 1. N-trans-Feruloyltyramine(NTF) has hepatoprotective effect. 2. NTF has antioxidative activity against Aβ(1-42)-induced neuronal death. 3. NTF is likely to inhibit COX enzymes, thereby suppressing P-selectin expression on platelets, is a platelet aggregation inhibitor. 4. NTF inhibits melanogenesis in a dose-dependent manner, NTF induces downregulation of tyrosinase resulted in suppression of melanin biosynthesis in murine B16 melanoma cells.
Molecular Weight: 313, 353
