Product Overview
Narirutin | T4S2164 | TargetMol Chemicals
CAS: 14259-46-2
Smiles: C[C@@H]1O[C@@H](OC[C@H]2O[C@@H](Oc3cc(O)c4C(=O)C[C@H](Oc4c3)c3ccc(O)cc3)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O)[C@H](O)[C@H]1O
Formula: C27H32O14
Pathway: Microbiology/Virology|||Others
Target: Others|||Antibacterial
Receptor: N/A
Bioactivity: 1. Narirutin has antiproliferative property. 2. Narirutin has anti-oxidant property. 3. Narirutin has anti-allergic and anti-inflammatory properties, can reduce airway inflammation in ovalbumin (OVA)-sensitized / challenged NC / Nga mice, a model of allergic eosinophilic airway inflammation.
Molecular Weight: 580, 539
