Product Overview
Nelumol A | TN4628 | TargetMol Chemicals
CAS: 77836-86-3
Smiles: COc1cc(\C=C\CO)cc(OC)c1OC\C=C(/C)CCC=C(C)C
Formula: C21H30O4
Pathway: Metabolism
Target: FXR
Receptor: N/A
Bioactivity: Nelumol A, and nelumal A show a potency comparable to the endogenous ligand, they may as a valuable potential novel lead compound in the search for FXR agonists.
Molecular Weight: 346, 5