Product Overview
Neobavaisoflavone | T6S0139 | TargetMol Chemicals
CAS: 41060-15-5
Smiles: CC(C)=CCc1cc(ccc1O)-c1coc2cc(O)ccc2c1=O
Formula: C20H18O4
Pathway: Apoptosis|||Cell Cycle/Checkpoint|||DNA Damage/DNA Repair
Target: Apoptosis|||DNA/RNA Synthesis
Receptor: N/A
Bioactivity: 1. Neobavaisoflavone is isolated as a DNA polymerase inhibitor. 2. Neobavaisoflavone might be a potential anabolic agent to treat bone loss-associated diseases. 3. Neobavaisoflavone has anti-inflammatory activity, can significantly inhibit the production of reactive oxygen species (ROS), reactive nitrogen species (RNS) and cytokines: IL-1β, IL-6, IL-12p4, IL-12p7, TNF-α in LPS+IFN-γ- or PMA- stimulated RAW264.7 macrophages.
Molecular Weight: 322, 36