Product Overview
nerolidol | T2S2172 | TargetMol Chemicals
CAS: 7212-44-4
Smiles: CC(C)=CCCC(C)=CCCC(C)(O)C=C
Formula: C15H26O
Pathway: Metabolism|||Microbiology/Virology|||Others
Target: Others|||Endogenous Metabolite|||Antibacterial|||Parasite|||Antifungal
Receptor: N/A
Bioactivity: 1. Nerolidol shows sedative effects in animals, oxidative process plays a crucial role on neuronal pathological consequence. 2. Nerolidol is mainly related to ROS and DNA single strand breaks generated by the presence of oxidative lesions.
Molecular Weight: 222, 372
