Product Overview
Nevirapine | T1595 | TargetMol Chemicals
CAS: 129618-40-2
Smiles: Cc1ccnc2N(C3CC3)c3ncccc3C(=O)Nc12
Formula: C15H14N4O
Pathway: Microbiology/Virology|||Proteases/Proteasome
Target: HIV Protease|||Reverse Transcriptase
Receptor: N/A
Bioactivity: Nevirapine is a benzodiazepine non-nucleoside reverse transcriptase inhibitor. In combination with other antiretroviral drugs, nevirapine reduces HIV viral loads and increases CD4 counts, thereby retarding or preventing the damage to the immune system and reducing the risk of developing AIDS.
Molecular Weight: 266, 304
