Product Overview
NH2-C2-amido-C2-Boc | T18484 | TargetMol Chemicals
CAS: 1692613-62-9
Smiles: CC(C)(C)OC(=O)CCC(=O)NCCN
Formula: C10H20N2O3
Pathway: Others
Target: Others
Receptor: N/A
Bioactivity: NH2-C2-amido-C2-Boc is a PROTAC linker, which refers to the alkyl/ether composition. NH2-C5-NH-Boc can be used in the synthesis of a series of PROTACs, such as the PROTAC CDK2/9 Degrader-1[1].
Molecular Weight: 216, 281
