Product Overview
Nootkatone | T3S0195 | TargetMol Chemicals
CAS: 4674-50-4
Smiles: C[C@@H]1CC(=O)C=C2CC[C@H](C[C@@]12C)C(C)=C
Formula: C15H22O
Pathway: PI3K/Akt/mTOR signaling
Target: AMPK
Receptor: N/A
Bioactivity: 1. Nootkatone can provide effective tick control. 2. (+)-Nootkatone has antiallergic, anti-inflammatory, and antiplatelet activities. 3. Nootkatone can prevent obesity and improve physical performance through AMPK activation in skeletal muscle and liver.
Molecular Weight: 218, 34
