Product Overview
Norisoboldine | T5S1895 | TargetMol Chemicals
CAS: 23599-69-1
Smiles: COc1cc-2c(C[C@@H]3NCCc4cc(OC)c(O)c-2c34)cc1O
Formula: C18H19NO4
Pathway: GPCR/G Protein|||MAPK|||Neuroscience
Target: MAPK|||Adenosine Receptor
Receptor: N/A
Bioactivity: 1. Norisoboldine might be a potential therapeutic agent for rheumatoid arthritis, and it functions through protecting joint destruction as well as regulating the abnormal immune responses. 2. Norisoboldine inhibits the macrophage activation and the resultant production of pro-inflammatory cytokines via down-regulating the activation of MAPKs signaling pathways rather than NF-κB.
Molecular Weight: 313, 353
