Product Overview
NT157 | T4605 | TargetMol Chemicals
CAS: 1384426-12-3
Smiles: Oc1cc(CNC(=S)\C=C\c2cc(O)c(O)c(Br)c2)cc(O)c1O
Formula: N/A
Pathway: JAK/STAT signaling|||Stem Cells|||Tyrosine Kinase/Adaptors
Target: IGF-1R|||STAT
Receptor: N/A
Bioactivity: NT157 is a small molecule tyrphostin targeting IRS protein and has the potential to inhibit IGF-1R and STAT3 signaling pathways in TME cancer cells and stromal cells, resulting in decreased cancer cell survival.
Molecular Weight: 412, 255
