Product Overview
Oleandrin | T5S0890 | TargetMol Chemicals
CAS: 465-16-7
Smiles: CO[C@H]1C[C@H](O[C@H]2CC[C@@]3(C)[C@H](CC[C@@H]4[C@@H]3CC[C@]3(C)[C@H]([C@H](C[C@]43O)OC(C)=O)C3=CC(=O)OC3)C2)O[C@@H](C)[C@@H]1O
Formula: C32H48O9
Pathway: Apoptosis|||Membrane transporter/Ion channel
Target: Apoptosis|||ATPase|||Potassium Channel|||Sodium Channel
Receptor: N/A
Bioactivity: 1. Oleandrin, the principal cardiac glycoside component of PBI-524, can quantitatively account for regulation of BDNF at both the protein and transcriptional levels. 2. Oleandrin are known to inhibit the Na, K-ATPase pump, resulting in a consequent increase in calcium influx in heart muscle. 3. Oleandrin has stronger anti-proliferative activity in undifferentiated CaCO-2 cells (IC50, 8.25 nM), causes an autophagic cell death and altered ERK phosphorylation in undifferentiated.
Molecular Weight: 576, 727
