Product Overview
ONO-2952 | T16393 | TargetMol Chemicals
CAS: 895169-20-7
Smiles: COc1cc(Cl)ccc1[C@@H]1N(CC2(CC2)c2c1[nH]c1cccc(F)c21)C(C)=O
Formula: C22H20ClFN2O2
Pathway: Others
Target: Others
Receptor: N/A
Bioactivity: ONO-2952 is more selective for TSPO than other receptors, transporters, ion channels, and enzymes. ONO-2952 is a potent and selective translocator protein 18 kDa (TSPO) antagonist (Ki: 0.33-9.30 nM for rat and human TSPO). ONO-2952 has the potential for irritable bowel syndrome treatment. ONO-2952 exerts its anti-stress effects through inhibition of excessive activation of the noradrenergic system in the brain without the amnesic effect.
Molecular Weight: 398, 86
