Product Overview
Ononin | T6S0270 | TargetMol Chemicals
CAS: 486-62-4
Smiles: COc1ccc(cc1)-c1coc2cc(O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)ccc2c1=O
Formula: C22H22O9
Pathway: Microbiology/Virology
Target: Antibacterial
Receptor: N/A
Bioactivity: 1. Ononin can inhibit the growth of pathogen. 2. Ononin plays an important role in human nutrition as health promoting natural chemicals and are established to be the beneficial components.
Molecular Weight: 430, 409
