Product Overview
Palbociclib-Succinic acid | T28291 | TargetMol Chemicals
CAS: T28291
Smiles: O=C1C(C(C)=O)=C(C2=CN=C(N=C2N1C3CCCC3)NC4=NC=C(C=C4)N5CCN(C(CCC(O)=O)=O)CC5)C
Formula: C28H33N7O5
Pathway: N/A
Target: N/A
Receptor: N/A
Bioactivity: Palbociclib-Succinic acid is a Palbociclib- derivative with a succinic acid linker. The carboxy group of Palbociclib-Succinic acid can be used to conjugate with other molecules such as peptides, proteins, or polymers. Palbociclib-Succinic acid is a useful agent to make Palbociclib-conjugate for drug delivery, nanodrug research.
Molecular Weight: 547, 62
