Product Overview
Palmatine | T5S0802 | TargetMol Chemicals
CAS: 3486-67-7
Smiles: COc1cc2CC[n+]3cc4c(OC)c(OC)ccc4cc3-c2cc1OC
Formula: C21H22NO4
Pathway: Metabolism|||Neuroscience
Target: Indoleamine 2, 3-Dioxygenase (IDO)|||AChR|||AChE
Receptor: N/A
Bioactivity: 1. Palmatine is an inhibitor of dopamine generation. 2. Palmatine could potentially be developed for the treatment of flavivirus infections. 3. Palmatine has been used in the treatment of jaundice, dysentery, hypertension, inflammation, and liver-related diseases.
Molecular Weight: 352, 409
 
             
             
                    
            
            
            
           