Product Overview
Panaxydol | TN2039 | TargetMol Chemicals
CAS: 72800-72-7
Smiles: CCCCCCC[C@@H]1O[C@@H]1CC#CC#C[C@H](O)C=C
Formula: C17H24O2
Pathway: GPCR/G Protein|||MAPK
Target: cAMP|||p38 MAPK|||JNK
Receptor: N/A
Bioactivity: Panaxydol has anti-cancer activity, can inhibit the growth and apoptosis of cancer cells, the signaling mechanisms involve a [Ca(2+)](i) increase, JNK and p38 MAPK activation, cAMP, MAP kinase and ROS generation through NADPH oxidase and mitochondria.
Molecular Weight: 260, 377