Product Overview
PF-04859989 HCl | T28368 | TargetMol Chemicals
CAS: 177943-33-8
Smiles: Cl.[O-][N+](=O)c1cccc(Cl)c1CBr
Formula: C7H6BrCl2NO2
Pathway: Others
Target: Others
Receptor: N/A
Bioactivity: PF-04859989 HCl is a brain-penetrable and irreversible inhibitor of kynurenine amino transferase II (KAT II), which is the enzyme responsible for most of the brain synthesis of kynurenic acid.
Molecular Weight: 286, 93
