Product Overview
Phthalimide-PEG3-C2-OTs | T18542 | TargetMol Chemicals
CAS: 382162-12-1
Smiles: Cc1ccc(cc1)S(=O)(=O)OCCOCCOCCOCCN1C(=O)c2ccccc2C1=O
Formula: C23H27NO8S
Pathway: Others
Target: Others
Receptor: N/A
Bioactivity: Phthalimide-PEG3-C2-OTs (Compound 5) is a PROTAC linker, which refers to the PEGs composition. Phthalimide-PEG3-C2-OTs can be used in the synthesis of a series of PROTACs. PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1].
Molecular Weight: 477, 53
