Product Overview
Phthalimide-PEG4-MPDM-OH | T18543 | TargetMol Chemicals
CAS: T18543
Smiles: O=C(N1CCOCCOCCOCCO[C@@H]2C[C@@H](CO)N(C)C2)C3=C(C=CC=C3)C1=O
Formula: C22H32N2O7
Pathway: Others
Target: Others
Receptor: N/A
Bioactivity: Phthalimide-PEG4-MPDM-OH is a PROTAC linker, which refers to the PEGs composition. Phthalimide-PEG4-MPDM-OH can be used in the synthesis of a series of PROTACs. PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1].
Molecular Weight: 436, 5
