Product Overview
Phthalimide-PEG4-PDM-OTBS | T18544 | TargetMol Chemicals
CAS: T18544
Smiles: O=C(N1CCOCCOCCOCCO[C@@H]2C[C@@H](CO[Si](C(C)(C)C)(C)C)NC2)C3=C(C=CC=C3)C1=O
Formula: C27H44N2O7Si
Pathway: Others
Target: Others
Receptor: N/A
Bioactivity: Phthalimide-PEG4-PDM-OTBS is a PROTAC linker, which refers to the PEGs composition. Phthalimide-PEG4-PDM-OTBS can be used in the synthesis of a series of PROTACs. PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1].
Molecular Weight: 536, 73
