Product Overview
Physalin B | TN2063 | TargetMol Chemicals
CAS: 23133-56-4
Smiles: C[C@@]12OC(=O)[C@@]3(O)CC[C@H]4[C@@H](CC=C5CC=CC(=O)[C@]45C)[C@]45O[C@@]13[C@@H](C4=O)[C@]1(C)C[C@H]2OC(=O)[C@@H]1CO5
Formula: C28H30O9
Pathway: Apoptosis|||Microbiology/Virology|||Proteases/Proteasome
Target: BCL|||Caspase|||Antifection
Receptor: N/A
Bioactivity: Physalin B shows antimalarial, anti-Trypanosoma cruzi, anti-bacterial, anti- leukemia activities, it has the potential to be developed as an effective chemotherapeutic lead compound for the treatment of malignant melanoma, it inhibits androgen-independent prostate cancer cell growth through activation of cell apoptosis and downregulation of androgen receptor expression.
Molecular Weight: 510, 539
