Product Overview
Picropodophyllin | T6943 | TargetMol Chemicals
CAS: 477-47-4
Smiles: COc1cc(cc(OC)c1OC)[C@H]1[C@H]2[C@H](COC2=O)[C@@H](O)c2cc3OCOc3cc12
Formula: C22H22O8
Pathway: Apoptosis|||Tyrosine Kinase/Adaptors
Target: Apoptosis|||IGF-1R
Receptor: N/A
Bioactivity: Picropodophyllin (PPP) is a specific IGF-1R inhibitor (IC50: 1 nM). Picropodophyllin specifically inhibits the activity and downregulates the cellular expression of IGF1R without interfering with activities of other growth factor receptors, such as receptors for insulin, epidermal growth factor, platelet-derived growth factor, fibroblast growth factor and mast/stem cell growth factor (KIT).
Molecular Weight: 414, 41