Product Overview
Pladienolide B | T16551 | TargetMol Chemicals
CAS: 445493-23-2
Smiles: CC[C@H](O)[C@@H](C)[C@H]1O[C@@H]1C[C@H](C)\C=C\C=C(/C)[C@H]1OC(=O)C[C@H](O)CC[C@@](C)(O)[C@@H](OC(C)=O)\C=C\[C@@H]1C
Formula: C30H48O8
Pathway: Others
Target: Others
Receptor: N/A
Bioactivity: Pladienolide B causes apoptosis. Pladienolide B is an effective cancer cell growth inhibitor that targets the SF3B1 subunit of the spliceosome. Pladienolide B exerts antitumor activities mediated through the inhibition of pre-mRNA splicing.
Molecular Weight: 536, 706
