Product Overview
Polyporusterone B | TN6909 | TargetMol Chemicals
CAS: 141360-89-6
Smiles: CC(C)C(=C)C[C@@H](O)[C@](C)(O)[C@H]1CC[C@]2(O)C3=CC(=O)[C@@H]4C[C@@H](O)[C@@H](O)C[C@]4(C)[C@H]3CC[C@]12C
Formula: C28H44O6
Pathway: Others
Target: Others
Receptor: N/A
Bioactivity: Polyporusterone B is a triterpene carboxylic acid isolated from Polyporus umbellatus Fries known as pentahydroxy bile acids, alcohols, and derivatives. Polyporusterone B Polyporusterone B has an inhibitory effect on free radical-induced lysis of red blood cells (hemolysis).
Molecular Weight: 476, 645385742188
