Product Overview
Pomalidomide-amido-C1-Br | T18552 | TargetMol Chemicals
CAS: 2351106-38-0
Smiles: BrCC(=O)Nc1cccc2C(=O)N(C3CCC(=O)NC3=O)C(=O)c12
Formula: C15H12BrN3O5
Pathway: Others
Target: Others
Receptor: N/A
Bioactivity: Pomalidomide-amido-C1-Br is a synthesized E3 ligase ligand-linker conjugate that incorporates the Pomalidomide based cereblon ligand and a linker. Pomalidomide-amido-C1-Br can be used to design a B-Raf PROTAC degrader PROTAC B-Raf degrader 1. PROTAC B-Raf degrader 1 has anti-cancer activity[1].
Molecular Weight: 394, 181
