Product Overview
Poncirin | T3S2312 | TargetMol Chemicals
CAS: 14941-08-3
Smiles: COc1ccc(cc1)[C@@H]1CC(=O)c2c(O)cc(O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O[C@@H]3O[C@@H](C)[C@H](O)[C@@H](O)[C@H]3O)cc2O1
Formula: C28H34O14
Pathway: Apoptosis|||Others
Target: Apoptosis|||Others
Receptor: N/A
Bioactivity: 1. Poncirin shows a significant in vitro inhibitory effect on the growth of the human gastric cancer cells, SGC-791, in a dose-dependent manner. 2. Poncirin prevents adipogenesis, enhances osteoblast differentiation in mesenchymal stem cellsincreased bone mineral density, and improves trabecular microarchitecture likely reflect increases bone formation and decreases bone resorption in GIO mice.
Molecular Weight: 594, 566