Product Overview
Pregnenolone monosulfate sodium salt | T16574 | TargetMol Chemicals
CAS: 1852-38-6
Smiles: [H][C@@]12CC[C@H](C(C)=O)[C@@]1(C)CC[C@@]1([H])[C@@]2([H])CC=C2C[C@H](CC[C@]12C)OS(=O)(=O)O[Na]
Formula: C21H31NaO5S
Pathway: Others
Target: Others
Receptor: N/A
Bioactivity: Pregnenolone monosulfate sodium salt is a powerful neurosteroid, the main precursor of various steroid hormones including steroid ketones. Pregnenolone monosulfate sodium salt can protect the brain from cannabis intoxication. Pregnenolone monosulfate sodium salt acts as a signaling-specific inhibitor of the cannabinoid CB1 receptor. Pregnenolone monosulfate sodium salt also inhibits the effects of tetrahydrocannabinol (THC) that are mediated by the CB1 receptors.
Molecular Weight: 418, 52
