Product Overview
Proguanil | T22409 | TargetMol Chemicals
CAS: 500-92-5
Smiles: CC(C)NC(=N)NC(=N)Nc1ccc(Cl)cc1
Formula: C11H16ClN5
Pathway: Others
Target: Others
Receptor: N/A
Bioactivity: Proguanil, a prophylactic antimalarial drug, inhibits the dihydrofolate reductase of plasmodia and thereby blocks the biosynthesis of pyrimidines and purines, which are essential for DNA synthesis and cell multiplication.
Molecular Weight: 253, 73
