Product Overview
PROTAC ERα Degrader-2 | T18605 | TargetMol Chemicals
CAS: 1351169-29-3
Smiles: C[C@@]12[C@](CC/C2=N\OCC(NCCOCCOCCNC([C@H](CC(C)C)NC([C@@H](O)[C@H](N)CC3=CC=CC=C3)=O)=O)=O)([H])[C@@]4([H])[C@](C5=CC=C(O)C=C5CC4)([H])CC1
Formula: C42H61N5O8
Pathway: Others
Target: Others
Receptor: N/A
Bioactivity: PROTAC ERα Degrader-2 comprises a cIAP1 ligand binding group, a linker and an estrogen receptor α (ERα) binding group. PROTAC ERα Degrader-2 is an ERα degrader. Maximal ERα degradation at 30 μM concentration in human mammary tumor MCF7 cells. Degradation inducers based on cIAP1 are called specific and non-genetic IAP-dependent protein erasers (SNIPERs)[1].
Molecular Weight: 763, 96
